C24H31NO6 — CID 132668747
methyl 2-[2-(4-tert-butylphenoxy)butanoylamino]-4,5-dimethoxybenzoate (PubChem CID 132668747) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is methyl 2-[2-(4-tert-butylphenoxy)butanoylamino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[2-(4-tert-butylphenoxy)butanoylamino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 132668747 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | methyl 2-[2-(4-tert-butylphenoxy)butanoylamino]-4,5-dimethoxybenzoate |
| SMILES | CCC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1cc(OC)c(OC)cc1C(=O)OC |
| InChI | InChI=1S/C24H31NO6/c1-8-19(31-16-11-9-15(10-12-16)24(2,3)4)22(26)25-18-14-21(29-6)20(28-5)13-17(18)23(27)30-7/h9-14,19H,8H2,1-7H3,(H,25,26) |
| InChIKey | JKBIKGRKGMQIAI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |