C23H29NO4 — CID 132657766
methyl 3-[2-(4-tert-butylphenoxy)butanoylamino]-4-methylbenzoate (PubChem CID 132657766) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 3-[2-(4-tert-butylphenoxy)butanoylamino]-4-methylbenzoate.
| Compound Name | methyl 3-[2-(4-tert-butylphenoxy)butanoylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 132657766 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | methyl 3-[2-(4-tert-butylphenoxy)butanoylamino]-4-methylbenzoate |
| SMILES | CCC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1cc(C(=O)OC)ccc1C |
| InChI | InChI=1S/C23H29NO4/c1-7-20(28-18-12-10-17(11-13-18)23(3,4)5)21(25)24-19-14-16(22(26)27-6)9-8-15(19)2/h8-14,20H,7H2,1-6H3,(H,24,25) |
| InChIKey | RGDVFRCKWLLUPY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |