C21H25FN2O5S — CID 132670733
ethyl 4-[2-(2-fluoro-N-methylsulfonylanilino)butanoylamino]-3-methylbenzoate (PubChem CID 132670733) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is ethyl 4-[2-(2-fluoro-N-methylsulfonylanilino)butanoylamino]-3-methylbenzoate.
| Compound Name | ethyl 4-[2-(2-fluoro-N-methylsulfonylanilino)butanoylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 132670733 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | ethyl 4-[2-(2-fluoro-N-methylsulfonylanilino)butanoylamino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(CC)N(c2ccccc2F)S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C21H25FN2O5S/c1-5-18(24(30(4,27)28)19-10-8-7-9-16(19)22)20(25)23-17-12-11-15(13-14(17)3)21(26)29-6-2/h7-13,18H,5-6H2,1-4H3,(H,23,25) |
| InChIKey | SGRFZIJXCOAAAF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |