C21H27ClN2O4S — CID 132671756
propan-2-yl 3-[(4-chlorophenyl)sulfamoyl]-4-(pentan-2-ylamino)benzoate (PubChem CID 132671756) has the molecular formula C21H27ClN2O4S and a molecular weight of 438.98 g/mol. Its IUPAC name is propan-2-yl 3-[(4-chlorophenyl)sulfamoyl]-4-(pentan-2-ylamino)benzoate.
| Compound Name | propan-2-yl 3-[(4-chlorophenyl)sulfamoyl]-4-(pentan-2-ylamino)benzoate |
|---|---|
| PubChem CID | 132671756 |
| Molecular Formula | C21H27ClN2O4S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | propan-2-yl 3-[(4-chlorophenyl)sulfamoyl]-4-(pentan-2-ylamino)benzoate |
| SMILES | CCCC(C)Nc1ccc(C(=O)OC(C)C)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN2O4S/c1-5-6-15(4)23-19-12-7-16(21(25)28-14(2)3)13-20(19)29(26,27)24-18-10-8-17(22)9-11-18/h7-15,23-24H,5-6H2,1-4H3 |
| InChIKey | XZPYGGIDLVHMJH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |