C26H36N2O4 — CID 132672105
2-[3-(3,4-diethoxyphenyl)propanoyl-(2-phenylethyl)amino]-N-ethylpropanamide (PubChem CID 132672105) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-[3-(3,4-diethoxyphenyl)propanoyl-(2-phenylethyl)amino]-N-ethylpropanamide.
| Compound Name | 2-[3-(3,4-diethoxyphenyl)propanoyl-(2-phenylethyl)amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132672105 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 2-[3-(3,4-diethoxyphenyl)propanoyl-(2-phenylethyl)amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(CCc1ccccc1)C(=O)CCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C26H36N2O4/c1-5-27-26(30)20(4)28(18-17-21-11-9-8-10-12-21)25(29)16-14-22-13-15-23(31-6-2)24(19-22)32-7-3/h8-13,15,19-20H,5-7,14,16-18H2,1-4H3,(H,27,30) |
| InChIKey | NVSXNWOHYOROBI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |