C17H18INO3S — CID 132672756
2-iodo-N-[1-(4-methylsulfonylphenyl)propyl]benzamide (PubChem CID 132672756) has the molecular formula C17H18INO3S and a molecular weight of 443.31 g/mol. Its IUPAC name is 2-iodo-N-[1-(4-methylsulfonylphenyl)propyl]benzamide.
| Compound Name | 2-iodo-N-[1-(4-methylsulfonylphenyl)propyl]benzamide |
|---|---|
| PubChem CID | 132672756 |
| Molecular Formula | C17H18INO3S |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 2-iodo-N-[1-(4-methylsulfonylphenyl)propyl]benzamide |
| SMILES | CCC(NC(=O)c1ccccc1I)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18INO3S/c1-3-16(12-8-10-13(11-9-12)23(2,21)22)19-17(20)14-6-4-5-7-15(14)18/h4-11,16H,3H2,1-2H3,(H,19,20) |
| InChIKey | JAKCBFLUQIODNO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|