C15H23NO3S — CID 95706556
2,2-dimethyl-N-[(1S)-1-(4-methylsulfonylphenyl)propyl]propanamide (PubChem CID 95706556) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1S)-1-(4-methylsulfonylphenyl)propyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(1S)-1-(4-methylsulfonylphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 95706556 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2,2-dimethyl-N-[(1S)-1-(4-methylsulfonylphenyl)propyl]propanamide |
| SMILES | CC[C@H](NC(=O)C(C)(C)C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23NO3S/c1-6-13(16-14(17)15(2,3)4)11-7-9-12(10-8-11)20(5,18)19/h7-10,13H,6H2,1-5H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | YWPOQQUNSPQIIY-ZDUSSCGKSA-N |
| XLogP | 2.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |