C15H25NO3S2 — CID 13267664
2,2-dimethyl-4-(2-methyl-3-sulfanylpropanoyl)-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid (PubChem CID 13267664) has the molecular formula C15H25NO3S2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-methyl-3-sulfanylpropanoyl)-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | 2,2-dimethyl-4-(2-methyl-3-sulfanylpropanoyl)-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 13267664 |
| Molecular Formula | C15H25NO3S2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2,2-dimethyl-4-(2-methyl-3-sulfanylpropanoyl)-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid |
| SMILES | CC(CS)C(=O)N1C(C(=O)O)C(C)(C)SC12CCCCC2 |
| InChI | InChI=1S/C15H25NO3S2/c1-10(9-20)12(17)16-11(13(18)19)14(2,3)21-15(16)7-5-4-6-8-15/h10-11,20H,4-9H2,1-3H3,(H,18,19) |
| InChIKey | RTGBJCVOXGZXHS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|