C22H25Cl2N3O4 — CID 132676855
2-[(2,4-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-propylbutanamide (PubChem CID 132676855) has the molecular formula C22H25Cl2N3O4 and a molecular weight of 466.37 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-propylbutanamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132676855 |
| Molecular Formula | C22H25Cl2N3O4 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1Cl)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25Cl2N3O4/c1-3-11-25-22(29)19(4-2)26(14-16-9-10-17(23)13-18(16)24)21(28)12-15-7-5-6-8-20(15)27(30)31/h5-10,13,19H,3-4,11-12,14H2,1-2H3,(H,25,29) |
| InChIKey | HECFJOPJZUHPAD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|