C21H24Cl3N3O4S — CID 132682991
2-[benzyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-methylbutanamide (PubChem CID 132682991) has the molecular formula C21H24Cl3N3O4S and a molecular weight of 520.87 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-methylbutanamide.
| Compound Name | 2-[benzyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132682991 |
| Molecular Formula | C21H24Cl3N3O4S |
| Molecular Weight | 520.87 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 2-[benzyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)N(Cc1ccccc1)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C21H24Cl3N3O4S/c1-4-18(21(29)25-2)26(12-14-8-6-5-7-9-14)20(28)13-27(32(3,30)31)19-11-16(23)15(22)10-17(19)24/h5-11,18H,4,12-13H2,1-3H3,(H,25,29) |
| InChIKey | VTGPIWBFEOQMNZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|