C23H28Cl3N3O4S — CID 132687691
N-ethyl-2-[(3-methylphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]butanamide (PubChem CID 132687691) has the molecular formula C23H28Cl3N3O4S and a molecular weight of 548.92 g/mol. Its IUPAC name is N-ethyl-2-[(3-methylphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]butanamide.
| Compound Name | N-ethyl-2-[(3-methylphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132687691 |
| Molecular Formula | C23H28Cl3N3O4S |
| Molecular Weight | 548.92 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | N-ethyl-2-[(3-methylphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]butanamide |
| SMILES | CCNC(=O)C(CC)N(Cc1cccc(C)c1)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C23H28Cl3N3O4S/c1-5-20(23(31)27-6-2)28(13-16-9-7-8-15(3)10-16)22(30)14-29(34(4,32)33)21-12-18(25)17(24)11-19(21)26/h7-12,20H,5-6,13-14H2,1-4H3,(H,27,31) |
| InChIKey | YFNSBKIPRXUDTO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|