C22H25Cl4N3O4S — CID 132691055
2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-ethylbutanamide (PubChem CID 132691055) has the molecular formula C22H25Cl4N3O4S and a molecular weight of 569.34 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-ethylbutanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 132691055 |
| Molecular Formula | C22H25Cl4N3O4S |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 567.03 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-ethylbutanamide |
| SMILES | CCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C22H25Cl4N3O4S/c1-4-19(22(31)27-5-2)28(12-14-8-6-7-9-15(14)23)21(30)13-29(34(3,32)33)20-11-17(25)16(24)10-18(20)26/h6-11,19H,4-5,12-13H2,1-3H3,(H,27,31) |
| InChIKey | LIPOOYQSLGPPFZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|