C24H28Cl5N3O4S — CID 132755454
2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-(2-methylpropyl)butanamide (PubChem CID 132755454) has the molecular formula C24H28Cl5N3O4S and a molecular weight of 631.84 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-(2-methylpropyl)butanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 132755454 |
| Molecular Formula | C24H28Cl5N3O4S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 629.02 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-(2-methylpropyl)butanamide |
| SMILES | CCC(C(=O)NCC(C)C)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C24H28Cl5N3O4S/c1-5-21(24(34)30-11-14(2)3)31(12-15-16(25)7-6-8-17(15)26)23(33)13-32(37(4,35)36)22-10-19(28)18(27)9-20(22)29/h6-10,14,21H,5,11-13H2,1-4H3,(H,30,34) |
| InChIKey | RGLVBAGWSVXTSQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|