About 2-(1,3-benzoxazol-2-yl)phenol
2-(1,3-benzoxazol-2-yl)phenol (PubChem CID 13269) has the molecular formula C13H9NO2
and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(1,3-benzoxazol-2-yl)phenol |
| PubChem CID | 13269 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)phenol |
| SMILES | Oc1ccccc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H9NO2/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-8,15H |
| InChIKey | GHGZVWOTJDLREY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,3-benzoxazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzoxazol-2-yl)phenol?
The IUPAC name of 2-(1,3-benzoxazol-2-yl)phenol (CID 13269) is 2-(1,3-benzoxazol-2-yl)phenol.
What is the SMILES notation for 2-(1,3-benzoxazol-2-yl)phenol?
The canonical SMILES for 2-(1,3-benzoxazol-2-yl)phenol is Oc1ccccc1-c1nc2ccccc2o1.
What is the InChIKey of 2-(1,3-benzoxazol-2-yl)phenol?
The InChIKey is GHGZVWOTJDLREY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-8,15H.
What are the key properties of 2-(1,3-benzoxazol-2-yl)phenol?
2-(1,3-benzoxazol-2-yl)phenol has a molecular weight of 211.22 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzoxazol-2-yl)phenol is sourced from PubChem (CID 13269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).