C22H26ClFN2O2 — CID 132706192
N-butyl-2-[(4-chlorophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]propanamide (PubChem CID 132706192) has the molecular formula C22H26ClFN2O2 and a molecular weight of 404.91 g/mol. Its IUPAC name is N-butyl-2-[(4-chlorophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(4-chlorophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132706192 |
| Molecular Formula | C22H26ClFN2O2 |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-butyl-2-[(4-chlorophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)cc1)C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C22H26ClFN2O2/c1-3-4-13-25-22(28)16(2)26(15-17-9-11-19(23)12-10-17)21(27)14-18-7-5-6-8-20(18)24/h5-12,16H,3-4,13-15H2,1-2H3,(H,25,28) |
| InChIKey | DHAUKQWMVHCBMK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|