C24H31FN2O2 — CID 100565173
(2S)-N-butyl-2-[[2-(3,5-dimethylphenyl)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 100565173) has the molecular formula C24H31FN2O2 and a molecular weight of 398.52 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(3,5-dimethylphenyl)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(3,5-dimethylphenyl)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100565173 |
| Molecular Formula | C24H31FN2O2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(3,5-dimethylphenyl)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccccc1F)C(=O)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H31FN2O2/c1-5-6-11-26-24(29)19(4)27(16-21-9-7-8-10-22(21)25)23(28)15-20-13-17(2)12-18(3)14-20/h7-10,12-14,19H,5-6,11,15-16H2,1-4H3,(H,26,29)/t19-/m0/s1 |
| InChIKey | ZIAQRUCXTJRRRX-IBGZPJMESA-N |
| XLogP | 4.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|