C24H31BrN2O2 — CID 133257632
2-[(4-bromophenyl)methyl-[2-(3,5-dimethylphenyl)acetyl]amino]-N-butylpropanamide (PubChem CID 133257632) has the molecular formula C24H31BrN2O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(3,5-dimethylphenyl)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(3,5-dimethylphenyl)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133257632 |
| Molecular Formula | C24H31BrN2O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(3,5-dimethylphenyl)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H31BrN2O2/c1-5-6-11-26-24(29)19(4)27(16-20-7-9-22(25)10-8-20)23(28)15-21-13-17(2)12-18(3)14-21/h7-10,12-14,19H,5-6,11,15-16H2,1-4H3,(H,26,29) |
| InChIKey | YLWOIRSUBZJHGQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|