C25H33FN2O2S — CID 132715270
N-butyl-2-[(4-fluorophenyl)methyl-[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]butanamide (PubChem CID 132715270) has the molecular formula C25H33FN2O2S and a molecular weight of 444.62 g/mol. Its IUPAC name is N-butyl-2-[(4-fluorophenyl)methyl-[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(4-fluorophenyl)methyl-[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132715270 |
| Molecular Formula | C25H33FN2O2S |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-butyl-2-[(4-fluorophenyl)methyl-[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(F)cc1)C(=O)CSCc1ccccc1C |
| InChI | InChI=1S/C25H33FN2O2S/c1-4-6-15-27-25(30)23(5-2)28(16-20-11-13-22(26)14-12-20)24(29)18-31-17-21-10-8-7-9-19(21)3/h7-14,23H,4-6,15-18H2,1-3H3,(H,27,30) |
| InChIKey | FFGWIHJUEGKYHV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|