C24H30ClFN2O2S — CID 132720922
N-butyl-2-[(2-chlorophenyl)methyl-[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]butanamide (PubChem CID 132720922) has the molecular formula C24H30ClFN2O2S and a molecular weight of 465.03 g/mol. Its IUPAC name is N-butyl-2-[(2-chlorophenyl)methyl-[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132720922 |
| Molecular Formula | C24H30ClFN2O2S |
| Molecular Weight | 465.03 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)CSCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H30ClFN2O2S/c1-3-5-14-27-24(30)22(4-2)28(15-19-8-6-7-9-21(19)25)23(29)17-31-16-18-10-12-20(26)13-11-18/h6-13,22H,3-5,14-17H2,1-2H3,(H,27,30) |
| InChIKey | MXKMIECKGVIHJW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.03 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|