C29H31Cl2FN2O2S — CID 100695859
(2R)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide (PubChem CID 100695859) has the molecular formula C29H31Cl2FN2O2S and a molecular weight of 561.55 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100695859 |
| Molecular Formula | C29H31Cl2FN2O2S |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | (2R)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CSCc1ccc(F)cc1 |
| InChI | InChI=1S/C29H31Cl2FN2O2S/c1-2-3-15-33-29(36)27(17-21-7-5-4-6-8-21)34(18-23-11-14-25(30)26(31)16-23)28(35)20-37-19-22-9-12-24(32)13-10-22/h4-14,16,27H,2-3,15,17-20H2,1H3,(H,33,36)/t27-/m1/s1 |
| InChIKey | CARMNWLAHKLMJN-HHHXNRCGSA-N |
| XLogP | 6.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|