C30H34Cl2N2O3S — CID 100712861
(2R)-N-butyl-2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100712861) has the molecular formula C30H34Cl2N2O3S and a molecular weight of 573.59 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100712861 |
| Molecular Formula | C30H34Cl2N2O3S |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | (2R)-N-butyl-2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H34Cl2N2O3S/c1-3-4-15-33-30(36)28(18-22-9-6-5-7-10-22)34(19-23-11-8-12-25(16-23)37-2)29(35)21-38-20-24-13-14-26(31)27(32)17-24/h5-14,16-17,28H,3-4,15,18-21H2,1-2H3,(H,33,36)/t28-/m1/s1 |
| InChIKey | QCMNRVDAMMFLDO-MUUNZHRXSA-N |
| XLogP | 6.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|