C29H31Cl3N2O2S — CID 133207004
N-butyl-2-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133207004) has the molecular formula C29H31Cl3N2O2S and a molecular weight of 578.01 g/mol. Its IUPAC name is N-butyl-2-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207004 |
| Molecular Formula | C29H31Cl3N2O2S |
| Molecular Weight | 578.01 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | N-butyl-2-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C29H31Cl3N2O2S/c1-2-3-14-33-29(36)27(17-21-8-5-4-6-9-21)34(18-22-12-13-25(31)26(32)16-22)28(35)20-37-19-23-10-7-11-24(30)15-23/h4-13,15-16,27H,2-3,14,17-20H2,1H3,(H,33,36) |
| InChIKey | DKRPKOCQWXYDQD-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.01 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|