C29H30Cl4N2O2S — CID 100689402
(2S)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide (PubChem CID 100689402) has the molecular formula C29H30Cl4N2O2S and a molecular weight of 612.45 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100689402 |
| Molecular Formula | C29H30Cl4N2O2S |
| Molecular Weight | 612.45 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | (2S)-N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C29H30Cl4N2O2S/c1-2-3-14-34-29(37)27(16-20-8-5-4-6-9-20)35(17-21-12-13-25(32)26(33)15-21)28(36)19-38-18-22-23(30)10-7-11-24(22)31/h4-13,15,27H,2-3,14,16-19H2,1H3,(H,34,37)/t27-/m0/s1 |
| InChIKey | XXPDRXJXPXVECK-MHZLTWQESA-N |
| XLogP | 8.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.45 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|