C23H26Cl4N2O2S — CID 132735261
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]propanamide (PubChem CID 132735261) has the molecular formula C23H26Cl4N2O2S and a molecular weight of 536.35 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132735261 |
| Molecular Formula | C23H26Cl4N2O2S |
| Molecular Weight | 536.35 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H26Cl4N2O2S/c1-3-4-10-28-23(31)15(2)29(12-16-8-9-20(26)21(27)11-16)22(30)14-32-13-17-18(24)6-5-7-19(17)25/h5-9,11,15H,3-4,10,12-14H2,1-2H3,(H,28,31) |
| InChIKey | VNIQRUMHFZUBER-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.35 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|