C23H27Cl3N2O2S — CID 133258031
N-butyl-2-[(3-chlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]propanamide (PubChem CID 133258031) has the molecular formula C23H27Cl3N2O2S and a molecular weight of 501.91 g/mol. Its IUPAC name is N-butyl-2-[(3-chlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(3-chlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 133258031 |
| Molecular Formula | C23H27Cl3N2O2S |
| Molecular Weight | 501.91 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | N-butyl-2-[(3-chlorophenyl)methyl-[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Cl)c1)C(=O)CSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H27Cl3N2O2S/c1-3-4-11-27-23(30)16(2)28(13-17-7-5-8-18(24)12-17)22(29)15-31-14-19-20(25)9-6-10-21(19)26/h5-10,12,16H,3-4,11,13-15H2,1-2H3,(H,27,30) |
| InChIKey | AJVYNCLBYMPMEX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.91 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|