C22H25Cl3N2O2 — CID 132718466
N-butyl-2-[[2-(3-chlorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]propanamide (PubChem CID 132718466) has the molecular formula C22H25Cl3N2O2 and a molecular weight of 455.81 g/mol. Its IUPAC name is N-butyl-2-[[2-(3-chlorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(3-chlorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132718466 |
| Molecular Formula | C22H25Cl3N2O2 |
| Molecular Weight | 455.81 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-butyl-2-[[2-(3-chlorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25Cl3N2O2/c1-3-4-11-26-22(29)15(2)27(14-18-19(24)9-6-10-20(18)25)21(28)13-16-7-5-8-17(23)12-16/h5-10,12,15H,3-4,11,13-14H2,1-2H3,(H,26,29) |
| InChIKey | IZKQBQZVHPIPGA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.81 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|