C22H24Cl4N2O2 — CID 132986665
N-butyl-2-[[2-(3,4-dichlorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]propanamide (PubChem CID 132986665) has the molecular formula C22H24Cl4N2O2 and a molecular weight of 490.26 g/mol. Its IUPAC name is N-butyl-2-[[2-(3,4-dichlorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(3,4-dichlorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132986665 |
| Molecular Formula | C22H24Cl4N2O2 |
| Molecular Weight | 490.26 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | N-butyl-2-[[2-(3,4-dichlorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl4N2O2/c1-3-4-10-27-22(30)14(2)28(13-16-17(23)6-5-7-18(16)24)21(29)12-15-8-9-19(25)20(26)11-15/h5-9,11,14H,3-4,10,12-13H2,1-2H3,(H,27,30) |
| InChIKey | GBYRGRLKTVWSSE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.26 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|