C28H34N2O3 — CID 132715904
N-butyl-2-[(2-naphthalen-1-yloxyacetyl)-(2-phenylethyl)amino]butanamide (PubChem CID 132715904) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is N-butyl-2-[(2-naphthalen-1-yloxyacetyl)-(2-phenylethyl)amino]butanamide.
| Compound Name | N-butyl-2-[(2-naphthalen-1-yloxyacetyl)-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132715904 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | N-butyl-2-[(2-naphthalen-1-yloxyacetyl)-(2-phenylethyl)amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(CCc1ccccc1)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C28H34N2O3/c1-3-5-19-29-28(32)25(4-2)30(20-18-22-12-7-6-8-13-22)27(31)21-33-26-17-11-15-23-14-9-10-16-24(23)26/h6-17,25H,3-5,18-21H2,1-2H3,(H,29,32) |
| InChIKey | UHXPZVXMMNUFBI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|