C27H31ClN2O2 — CID 132717149
N-tert-butyl-2-[(2-chlorophenyl)methyl-(3-naphthalen-1-ylpropanoyl)amino]propanamide (PubChem CID 132717149) has the molecular formula C27H31ClN2O2 and a molecular weight of 451.01 g/mol. Its IUPAC name is N-tert-butyl-2-[(2-chlorophenyl)methyl-(3-naphthalen-1-ylpropanoyl)amino]propanamide.
| Compound Name | N-tert-butyl-2-[(2-chlorophenyl)methyl-(3-naphthalen-1-ylpropanoyl)amino]propanamide |
|---|---|
| PubChem CID | 132717149 |
| Molecular Formula | C27H31ClN2O2 |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-tert-butyl-2-[(2-chlorophenyl)methyl-(3-naphthalen-1-ylpropanoyl)amino]propanamide |
| SMILES | CC(C(=O)NC(C)(C)C)N(Cc1ccccc1Cl)C(=O)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H31ClN2O2/c1-19(26(32)29-27(2,3)4)30(18-22-11-6-8-15-24(22)28)25(31)17-16-21-13-9-12-20-10-5-7-14-23(20)21/h5-15,19H,16-18H2,1-4H3,(H,29,32) |
| InChIKey | RIWMMAJHEJRRFJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |