C23H28Cl2N2O2 — CID 133145508
N-tert-butyl-2-[(3-chlorophenyl)methyl-[3-(2-chlorophenyl)propanoyl]amino]propanamide (PubChem CID 133145508) has the molecular formula C23H28Cl2N2O2 and a molecular weight of 435.40 g/mol. Its IUPAC name is N-tert-butyl-2-[(3-chlorophenyl)methyl-[3-(2-chlorophenyl)propanoyl]amino]propanamide.
| Compound Name | N-tert-butyl-2-[(3-chlorophenyl)methyl-[3-(2-chlorophenyl)propanoyl]amino]propanamide |
|---|---|
| PubChem CID | 133145508 |
| Molecular Formula | C23H28Cl2N2O2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-tert-butyl-2-[(3-chlorophenyl)methyl-[3-(2-chlorophenyl)propanoyl]amino]propanamide |
| SMILES | CC(C(=O)NC(C)(C)C)N(Cc1cccc(Cl)c1)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C23H28Cl2N2O2/c1-16(22(29)26-23(2,3)4)27(15-17-8-7-10-19(24)14-17)21(28)13-12-18-9-5-6-11-20(18)25/h5-11,14,16H,12-13,15H2,1-4H3,(H,26,29) |
| InChIKey | UNXBMVNCTQMQJS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |