C27H38N2O4 — CID 132718126
N-butan-2-yl-2-[4-(4-methoxyphenoxy)butanoyl-(2-phenylethyl)amino]butanamide (PubChem CID 132718126) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-(4-methoxyphenoxy)butanoyl-(2-phenylethyl)amino]butanamide.
| Compound Name | N-butan-2-yl-2-[4-(4-methoxyphenoxy)butanoyl-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132718126 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N-butan-2-yl-2-[4-(4-methoxyphenoxy)butanoyl-(2-phenylethyl)amino]butanamide |
| SMILES | CCC(C)NC(=O)C(CC)N(CCc1ccccc1)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H38N2O4/c1-5-21(3)28-27(31)25(6-2)29(19-18-22-11-8-7-9-12-22)26(30)13-10-20-33-24-16-14-23(32-4)15-17-24/h7-9,11-12,14-17,21,25H,5-6,10,13,18-20H2,1-4H3,(H,28,31) |
| InChIKey | KSZZDEQDJYFCNQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|