C24H30Cl2N2O3 — CID 132721104
N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-phenoxybutanamide (PubChem CID 132721104) has the molecular formula C24H30Cl2N2O3 and a molecular weight of 465.42 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-phenoxybutanamide.
| Compound Name | N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 132721104 |
| Molecular Formula | C24H30Cl2N2O3 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-phenoxybutanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C24H30Cl2N2O3/c1-3-4-15-27-24(30)18(2)28(17-20-21(25)12-8-13-22(20)26)23(29)14-9-16-31-19-10-6-5-7-11-19/h5-8,10-13,18H,3-4,9,14-17H2,1-2H3,(H,27,30) |
| InChIKey | PDMSQIMNMLHGJX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|