C26H37FN4O4S — CID 132731230
N-butyl-2-[[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]-(2-phenylethyl)amino]butanamide (PubChem CID 132731230) has the molecular formula C26H37FN4O4S and a molecular weight of 520.67 g/mol. Its IUPAC name is N-butyl-2-[[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]-(2-phenylethyl)amino]butanamide.
| Compound Name | N-butyl-2-[[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132731230 |
| Molecular Formula | C26H37FN4O4S |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | N-butyl-2-[[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]-(2-phenylethyl)amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(CCc1ccccc1)C(=O)CN(c1ccccc1F)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C26H37FN4O4S/c1-5-7-18-28-26(33)23(6-2)30(19-17-21-13-9-8-10-14-21)25(32)20-31(36(34,35)29(3)4)24-16-12-11-15-22(24)27/h8-16,23H,5-7,17-20H2,1-4H3,(H,28,33) |
| InChIKey | LYAJNNDRBCLTTQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|