C23H29IN2O4 — CID 132732321
N-butyl-2-[[2-(4-iodophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132732321) has the molecular formula C23H29IN2O4 and a molecular weight of 524.40 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-iodophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(4-iodophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132732321 |
| Molecular Formula | C23H29IN2O4 |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | N-butyl-2-[[2-(4-iodophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C23H29IN2O4/c1-4-5-14-25-23(28)17(2)26(15-18-6-10-20(29-3)11-7-18)22(27)16-30-21-12-8-19(24)9-13-21/h6-13,17H,4-5,14-16H2,1-3H3,(H,25,28) |
| InChIKey | VWUZZFBAEZJZHP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|