C24H31ClN2O5 — CID 132720298
N-butyl-2-[(4-chlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]propanamide (PubChem CID 132720298) has the molecular formula C24H31ClN2O5 and a molecular weight of 462.97 g/mol. Its IUPAC name is N-butyl-2-[(4-chlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(4-chlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132720298 |
| Molecular Formula | C24H31ClN2O5 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-butyl-2-[(4-chlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)cc1)C(=O)COc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C24H31ClN2O5/c1-5-6-11-26-24(29)17(2)27(15-18-7-9-19(25)10-8-18)23(28)16-32-22-13-20(30-3)12-21(14-22)31-4/h7-10,12-14,17H,5-6,11,15-16H2,1-4H3,(H,26,29) |
| InChIKey | PMQQSFFMLDOCSJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|