C25H32F3N3O4S — CID 132732939
N-butyl-2-[[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-(2-phenylethyl)amino]propanamide (PubChem CID 132732939) has the molecular formula C25H32F3N3O4S and a molecular weight of 527.61 g/mol. Its IUPAC name is N-butyl-2-[[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-(2-phenylethyl)amino]propanamide.
| Compound Name | N-butyl-2-[[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-(2-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 132732939 |
| Molecular Formula | C25H32F3N3O4S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-butyl-2-[[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-(2-phenylethyl)amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(CCc1ccccc1)C(=O)CN(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C25H32F3N3O4S/c1-4-5-15-29-24(33)19(2)30(16-14-20-10-7-6-8-11-20)23(32)18-31(36(3,34)35)22-13-9-12-21(17-22)25(26,27)28/h6-13,17,19H,4-5,14-16,18H2,1-3H3,(H,29,33) |
| InChIKey | XACWBBQMEOXZHU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|