C24H31Cl2N3O4S — CID 132733204
N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]propanamide (PubChem CID 132733204) has the molecular formula C24H31Cl2N3O4S and a molecular weight of 528.50 g/mol. Its IUPAC name is N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132733204 |
| Molecular Formula | C24H31Cl2N3O4S |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(C)c1)C(=O)CN(c1cccc(Cl)c1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C24H31Cl2N3O4S/c1-5-6-13-27-24(31)18(3)28(15-19-10-7-9-17(2)14-19)22(30)16-29(34(4,32)33)21-12-8-11-20(25)23(21)26/h7-12,14,18H,5-6,13,15-16H2,1-4H3,(H,27,31) |
| InChIKey | FUYQEOXJKYTGIY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|