C29H32BrCl2N3O4S — CID 100570870
(2S)-2-[(3-bromophenyl)methyl-[2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 100570870) has the molecular formula C29H32BrCl2N3O4S and a molecular weight of 669.47 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100570870 |
| Molecular Formula | C29H32BrCl2N3O4S |
| Molecular Weight | 669.47 g/mol |
| Exact Mass | 667.07 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Br)c1)C(=O)CN(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H32BrCl2N3O4S/c1-4-5-16-33-29(37)21(3)34(18-22-8-6-9-23(30)17-22)27(36)19-35(26-11-7-10-25(31)28(26)32)40(38,39)24-14-12-20(2)13-15-24/h6-15,17,21H,4-5,16,18-19H2,1-3H3,(H,33,37)/t21-/m0/s1 |
| InChIKey | JMGSXYKYYATBHI-NRFANRHFSA-N |
| XLogP | 6.59 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.47 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|