C29H33BrClN3O4S — CID 100566894
(2S)-2-[(3-bromophenyl)methyl-[2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 100566894) has the molecular formula C29H33BrClN3O4S and a molecular weight of 635.02 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100566894 |
| Molecular Formula | C29H33BrClN3O4S |
| Molecular Weight | 635.02 g/mol |
| Exact Mass | 633.11 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Br)c1)C(=O)CN(c1ccccc1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H33BrClN3O4S/c1-4-5-17-32-29(36)22(3)33(19-23-9-8-10-24(30)18-23)28(35)20-34(27-12-7-6-11-26(27)31)39(37,38)25-15-13-21(2)14-16-25/h6-16,18,22H,4-5,17,19-20H2,1-3H3,(H,32,36)/t22-/m0/s1 |
| InChIKey | MKKGATZRWYFIMQ-QFIPXVFZSA-N |
| XLogP | 5.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.02 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|