C27H30BrFN2O3 — CID 132733416
2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(4-fluorophenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132733416) has the molecular formula C27H30BrFN2O3 and a molecular weight of 529.45 g/mol. Its IUPAC name is 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(4-fluorophenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(4-fluorophenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132733416 |
| Molecular Formula | C27H30BrFN2O3 |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(4-fluorophenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(F)cc1)C(=O)COc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C27H30BrFN2O3/c1-3-5-16-30-27(33)23(4-2)31(17-19-10-13-21(29)14-11-19)25(32)18-34-24-15-12-20-8-6-7-9-22(20)26(24)28/h6-15,23H,3-5,16-18H2,1-2H3,(H,30,33) |
| InChIKey | WWAGQEISVGSLIG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|