C32H32BrFN2O3 — CID 133231989
2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(2-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133231989) has the molecular formula C32H32BrFN2O3 and a molecular weight of 591.52 g/mol. Its IUPAC name is 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(2-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(2-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133231989 |
| Molecular Formula | C32H32BrFN2O3 |
| Molecular Weight | 591.52 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(2-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1F)C(=O)COc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C32H32BrFN2O3/c1-2-3-19-35-32(38)28(20-23-11-5-4-6-12-23)36(21-25-14-8-10-16-27(25)34)30(37)22-39-29-18-17-24-13-7-9-15-26(24)31(29)33/h4-18,28H,2-3,19-22H2,1H3,(H,35,38) |
| InChIKey | WGYXTAKDWGGGRJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|