C27H37N3O6S — CID 132733859
4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[1-(butylamino)-1-oxopropan-2-yl]-N-(2-phenylethyl)butanamide (PubChem CID 132733859) has the molecular formula C27H37N3O6S and a molecular weight of 531.68 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[1-(butylamino)-1-oxopropan-2-yl]-N-(2-phenylethyl)butanamide.
| Compound Name | 4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[1-(butylamino)-1-oxopropan-2-yl]-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 132733859 |
| Molecular Formula | C27H37N3O6S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[1-(butylamino)-1-oxopropan-2-yl]-N-(2-phenylethyl)butanamide |
| SMILES | CCCCNC(=O)C(C)N(CCc1ccccc1)C(=O)CCCN(c1ccc2c(c1)OCO2)S(C)(=O)=O |
| InChI | InChI=1S/C27H37N3O6S/c1-4-5-16-28-27(32)21(2)29(18-15-22-10-7-6-8-11-22)26(31)12-9-17-30(37(3,33)34)23-13-14-24-25(19-23)36-20-35-24/h6-8,10-11,13-14,19,21H,4-5,9,12,15-18,20H2,1-3H3,(H,28,32) |
| InChIKey | YHGKJSOAZSHSFB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|