C27H36ClN3O6S — CID 132742369
2-[4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]butanoyl-[(2-chlorophenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132742369) has the molecular formula C27H36ClN3O6S and a molecular weight of 566.12 g/mol. Its IUPAC name is 2-[4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]butanoyl-[(2-chlorophenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]butanoyl-[(2-chlorophenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132742369 |
| Molecular Formula | C27H36ClN3O6S |
| Molecular Weight | 566.12 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 2-[4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]butanoyl-[(2-chlorophenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)CCCN(c1ccc2c(c1)OCO2)S(C)(=O)=O |
| InChI | InChI=1S/C27H36ClN3O6S/c1-4-6-15-29-27(33)23(5-2)30(18-20-10-7-8-11-22(20)28)26(32)12-9-16-31(38(3,34)35)21-13-14-24-25(17-21)37-19-36-24/h7-8,10-11,13-14,17,23H,4-6,9,12,15-16,18-19H2,1-3H3,(H,29,33) |
| InChIKey | BVRTTYCFFIMPKG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.12 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|