C28H37Cl2N3O6S — CID 132752935
N-butyl-2-[(2,6-dichlorophenyl)methyl-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]butanoyl]amino]butanamide (PubChem CID 132752935) has the molecular formula C28H37Cl2N3O6S and a molecular weight of 614.59 g/mol. Its IUPAC name is N-butyl-2-[(2,6-dichlorophenyl)methyl-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]butanoyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]butanoyl]amino]butanamide |
|---|---|
| PubChem CID | 132752935 |
| Molecular Formula | C28H37Cl2N3O6S |
| Molecular Weight | 614.59 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]butanoyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1c(Cl)cccc1Cl)C(=O)CCCN(c1ccc2c(c1)OCCO2)S(C)(=O)=O |
| InChI | InChI=1S/C28H37Cl2N3O6S/c1-4-6-14-31-28(35)24(5-2)32(19-21-22(29)9-7-10-23(21)30)27(34)11-8-15-33(40(3,36)37)20-12-13-25-26(18-20)39-17-16-38-25/h7,9-10,12-13,18,24H,4-6,8,11,14-17,19H2,1-3H3,(H,31,35) |
| InChIKey | WRCXZZUIVATFTC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|