C29H41N3O7S — CID 132744657
N-butyl-2-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132744657) has the molecular formula C29H41N3O7S and a molecular weight of 575.73 g/mol. Its IUPAC name is N-butyl-2-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132744657 |
| Molecular Formula | C29H41N3O7S |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | N-butyl-2-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)CCCN(c1ccc2c(c1)OCCO2)S(C)(=O)=O |
| InChI | InChI=1S/C29H41N3O7S/c1-5-7-15-30-29(34)25(6-2)31(21-22-10-8-11-24(19-22)37-3)28(33)12-9-16-32(40(4,35)36)23-13-14-26-27(20-23)39-18-17-38-26/h8,10-11,13-14,19-20,25H,5-7,9,12,15-18,21H2,1-4H3,(H,30,34) |
| InChIKey | ROJIGXNMNUCMAQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|