C28H41N3O5S — CID 132733999
N-[1-(butylamino)-1-oxopropan-2-yl]-4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[(4-methoxyphenyl)methyl]butanamide (PubChem CID 132733999) has the molecular formula C28H41N3O5S and a molecular weight of 531.72 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxopropan-2-yl]-4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[(4-methoxyphenyl)methyl]butanamide.
| Compound Name | N-[1-(butylamino)-1-oxopropan-2-yl]-4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[(4-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 132733999 |
| Molecular Formula | C28H41N3O5S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | N-[1-(butylamino)-1-oxopropan-2-yl]-4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[(4-methoxyphenyl)methyl]butanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)CCCN(c1cc(C)cc(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C28H41N3O5S/c1-7-8-15-29-28(33)23(4)30(20-24-11-13-26(36-5)14-12-24)27(32)10-9-16-31(37(6,34)35)25-18-21(2)17-22(3)19-25/h11-14,17-19,23H,7-10,15-16,20H2,1-6H3,(H,29,33) |
| InChIKey | SRYVSUJUFKXINV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|