C26H35F2N3O5S — CID 132735931
N-[1-(butylamino)-1-oxopropan-2-yl]-4-(3,4-difluoro-N-methylsulfonylanilino)-N-[(4-methoxyphenyl)methyl]butanamide (PubChem CID 132735931) has the molecular formula C26H35F2N3O5S and a molecular weight of 539.65 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxopropan-2-yl]-4-(3,4-difluoro-N-methylsulfonylanilino)-N-[(4-methoxyphenyl)methyl]butanamide.
| Compound Name | N-[1-(butylamino)-1-oxopropan-2-yl]-4-(3,4-difluoro-N-methylsulfonylanilino)-N-[(4-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 132735931 |
| Molecular Formula | C26H35F2N3O5S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | N-[1-(butylamino)-1-oxopropan-2-yl]-4-(3,4-difluoro-N-methylsulfonylanilino)-N-[(4-methoxyphenyl)methyl]butanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)CCCN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C26H35F2N3O5S/c1-5-6-15-29-26(33)19(2)30(18-20-9-12-22(36-3)13-10-20)25(32)8-7-16-31(37(4,34)35)21-11-14-23(27)24(28)17-21/h9-14,17,19H,5-8,15-16,18H2,1-4H3,(H,29,33) |
| InChIKey | CPDHSMWRDVXXRR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|