C24H29BrCl2N2O3 — CID 132737062
2-[[2-(4-bromo-3-methylphenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132737062) has the molecular formula C24H29BrCl2N2O3 and a molecular weight of 544.32 g/mol. Its IUPAC name is 2-[[2-(4-bromo-3-methylphenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-(4-bromo-3-methylphenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132737062 |
| Molecular Formula | C24H29BrCl2N2O3 |
| Molecular Weight | 544.32 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 2-[[2-(4-bromo-3-methylphenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1c(Cl)cccc1Cl)C(=O)COc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C24H29BrCl2N2O3/c1-4-6-12-28-24(31)22(5-2)29(14-18-20(26)8-7-9-21(18)27)23(30)15-32-17-10-11-19(25)16(3)13-17/h7-11,13,22H,4-6,12,14-15H2,1-3H3,(H,28,31) |
| InChIKey | JCJXBRRQZPZGOO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.32 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|