C23H26BrCl3N2O3 — CID 132741879
2-[[2-(2-bromo-4-chlorophenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132741879) has the molecular formula C23H26BrCl3N2O3 and a molecular weight of 564.74 g/mol. Its IUPAC name is 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132741879 |
| Molecular Formula | C23H26BrCl3N2O3 |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1c(Cl)cccc1Cl)C(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C23H26BrCl3N2O3/c1-3-5-11-28-23(31)20(4-2)29(13-16-18(26)7-6-8-19(16)27)22(30)14-32-21-10-9-15(25)12-17(21)24/h6-10,12,20H,3-5,11,13-14H2,1-2H3,(H,28,31) |
| InChIKey | GAFBLISCNQOODY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|