C27H39N3O7S — CID 132738067
N-butyl-2-[[2-(3,4-dimethoxy-N-methylsulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132738067) has the molecular formula C27H39N3O7S and a molecular weight of 549.69 g/mol. Its IUPAC name is N-butyl-2-[[2-(3,4-dimethoxy-N-methylsulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(3,4-dimethoxy-N-methylsulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132738067 |
| Molecular Formula | C27H39N3O7S |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | N-butyl-2-[[2-(3,4-dimethoxy-N-methylsulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc(OC)c(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C27H39N3O7S/c1-7-9-15-28-27(32)23(8-2)29(18-20-11-10-12-22(16-20)35-3)26(31)19-30(38(6,33)34)21-13-14-24(36-4)25(17-21)37-5/h10-14,16-17,23H,7-9,15,18-19H2,1-6H3,(H,28,32) |
| InChIKey | DQXWOFYLUQQTFA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|